CAS 165881-36-7: (1S,2S,3R,5S)-(+)-2,3-PINANEDIOL 4-BROMOBUTYLBORONATE ESTER
Description:(1S,2S,3R,5S)-(+)-2,3-Pinanediol 4-Bromobutylboronate ester is a chiral organic compound characterized by its specific stereochemistry, which is indicated by the (1S,2S,3R,5S) configuration. This compound features a pinanediol backbone, which contributes to its rigidity and potential for forming hydrogen bonds due to the presence of hydroxyl groups. The addition of a 4-bromobutylboronate moiety enhances its reactivity, particularly in cross-coupling reactions, making it useful in synthetic organic chemistry. The boronate ester functionality is known for its ability to participate in various reactions, including Suzuki coupling, which is valuable in the formation of carbon-carbon bonds. The compound's chirality may influence its biological activity and interactions, making it of interest in medicinal chemistry. Overall, this substance is notable for its structural complexity, reactivity, and potential applications in organic synthesis and pharmaceutical development.
Formula:C14H24BBrO2
InChI:InChI=1/C14H24BBrO2/c1-13(2)10-8-11(13)14(3)12(9-10)17-15(18-14)6-4-5-7-16/h10-12H,4-9H2,1-3H3/t10-,11-,12+,14-/m0/s1
- Synonyms:
- 4- Bromobutylboronate ester
- 4-Bromobutaneboronic acid (1S,2S,3R,5S)-(+)-2,3-pinanediol ester
- 4-Bromobutylboronic acid (1S,2S,3R,5S)-(+)-2,3-pinanediol ester, 95%
![(3As,4s,6s,7ar)-2-(4-bromobutyl)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborole](https://static.cymitquimica.com/products/10/thumb/F696431.jpg)
