CAS 165948-23-2
:4,5,6,7-TETRAHYDRO-THIAZOLO[5,4-C]PYRIDINE HYDROCHLORIDE SALT
Description:
4,5,6,7-Tetrahydro-thiazolo[5,4-c]pyridine hydrochloride salt is a heterocyclic compound characterized by its unique bicyclic structure, which combines elements of both thiazole and pyridine. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride salt form enhances its stability and solubility, which is beneficial for pharmaceutical formulations. It is often studied for its potential biological activities, including antimicrobial and anti-inflammatory properties, due to the presence of nitrogen and sulfur atoms in its structure that can interact with biological targets. The compound's molecular structure contributes to its reactivity and potential as a building block in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H9ClN2S
InChI:InChI=1/C6H8N2S.ClH/c1-2-7-3-6-5(1)8-4-9-6;/h4,7H,1-3H2;1H
SMILES:C1CNCc2c1ncs2.Cl
Synonyms:- 4,5,6,7-Tetrahydrothiazolo[5,4-c]pyridine hydrochloride
- 4,5,6,7-Tetrahydro[1,3]Thiazolo[5,4-C]Pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
4,5,6,7-Tetrahydrothiazolo[5,4-c]pyridine
CAS:Formula:C6H8N2SColor and Shape:SolidMolecular weight:140.20614,5,6,7-Tetrahydrothiazolo[5,4-c]pyridine
CAS:Controlled ProductFormula:C6H8N2SColor and Shape:NeatMolecular weight:140.206



