CAS 165949-89-3

8-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]-5,6,7,8-tetrahydro-2-naphthalenecarboxylic acid

Description:

8-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]-5,6,7,8-tetrahydro-2-naphthalenecarboxylic acid, with CAS number 165949-89-3, is a chemical compound characterized by its complex structure, which includes a naphthalene ring system and a carboxylic acid functional group. This compound features a tetrahydro configuration, indicating the presence of a saturated cyclic structure, which contributes to its stability and reactivity. The presence of the dimethylethoxycarbonyl group suggests that it has protective or modifying functionalities, often utilized in organic synthesis to enhance solubility or reactivity. The amino group in the structure indicates potential for hydrogen bonding and reactivity in various chemical environments. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, this compound's unique structural features make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₇H₂₃NO₄

InChI: InChI=1S/C17H23NO4/c1-17(2,3)22-16(21)18-10-13-6-4-5-11-7-8-12(15(19)20)9-14(11)13/h7-9,13H,4-6,10H2,1-3H3,(H,18,21)(H,19,20)

InChI key: InChIKey=VJSMWHPYTVISHP-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)C1C=2C(=CC=C(C(O)=O)C2)CCC1

Synonyms:

• 2-Naphthalenecarboxylic acid, 8-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-5,6,7,8-tetrahydro-
• 8-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]-5,6,7,8-tetrahydro-2-naphthalenecarboxylic acid

8-({[(tert-Butoxy)carbonyl]amino}methyl)-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid

CAS: 165949-89-3

Versatile small molecule scaffold

Formula: C₁₇H₂₃NO₄

Purity: Min. 95%

Molecular weight: 305.4 g/mol

Ref: 3D-QGA94989