CAS 165963-57-5

4-Methyltricyclo[3.3.1.13,7]decane-1,4-diol

Description:

4-Methyltricyclo[3.3.1.1^3,7]decane-1,4-diol is a bicyclic organic compound characterized by its complex tricyclic structure, which includes three interconnected rings. The presence of a methyl group at the fourth position contributes to its unique properties, while the diol functional group indicates the presence of two hydroxyl (-OH) groups, which can influence its reactivity and solubility. This compound is typically colorless to pale yellow and may exhibit a solid or semi-solid state at room temperature, depending on its specific formulation and purity. The hydroxyl groups can engage in hydrogen bonding, enhancing its solubility in polar solvents and affecting its boiling and melting points. Additionally, the compound's structure may impart specific stereochemical configurations, influencing its biological activity and potential applications in fields such as pharmaceuticals or materials science. Overall, 4-Methyltricyclo[3.3.1.1^3,7]decane-1,4-diol is notable for its intricate structure and functional groups, which contribute to its chemical behavior and potential utility in various applications.

Formula: C₁₁H₁₈O₂

InChI: InChI=1S/C11H18O2/c1-10(12)8-2-7-3-9(10)6-11(13,4-7)5-8/h7-9,12-13H,2-6H2,1H3

InChI key: InChIKey=ALZUAKQPIUGQKR-UHFFFAOYSA-N

SMILES: OC12CC3C(C)(O)C(C1)CC(C2)C3

Synonyms:

• 2-Methyl-2,5-Adamantanediol
• 4-Methyltricyclo[3.3.1.1^3,7]decane-1,4-diol
• 5-Hydroxy-2-Methyl-2-Adamantanol
• Tricyclo[3.3.1.1^3,7]decane-1,4-diol, 4-methyl-
• Tricyclo[3.3.1.13,7]decane-1,4-diol, 4-methyl-
• 4-Methyltricyclo[3.3.1.13,7]decane-1,4-diol
• 4-Methyl-1,4-adamantanediol

4-Methyladamantane-1,4-diol

CAS: 165963-57-5

Formula: C₁₁H₁₈O₂

Molecular weight: 182.2594

Ref: IN-DA001WFS

5-Hydroxy-2-methyl-2-adamantanol

CAS: 165963-57-5

5-Hydroxy-2-methyl-2-adamantanol is a fine chemical that is used as a building block in research and development of various products. It can be used to make other substances, such as pharmaceuticals and cosmetics. 5-Hydroxy-2-methyl-2-adamantanol is also a versatile intermediate in the synthesis of complex molecules, such as peptides and polymers. This product is soluble in water and has a high quality standard. It is also an excellent reagent for many reactions, such as condensation, esterification, nitration, oxidation, reduction, and decarboxylation.

Formula: C₁₁H₁₈O₂

Purity: Min. 95%

Molecular weight: 182.26 g/mol

Ref: 3D-FH66634