CAS 166021-01-8
:6-O-(triisopropylsilyl)-D-galactal
Description:
6-O-(Triisopropylsilyl)-D-galactal is a chemical compound that belongs to the class of galactose derivatives, specifically modified sugars. It features a triisopropylsilyl (TIPS) protecting group at the 6-position of the galactal structure, which is a sugar alcohol derived from galactose. The presence of the TIPS group enhances the compound's stability and solubility in organic solvents, making it useful in various synthetic applications, particularly in carbohydrate chemistry. This modification allows for selective reactions at other functional groups while protecting the hydroxyl group at the 6-position. The compound is typically used in the synthesis of more complex carbohydrate structures and can serve as an intermediate in the preparation of glycosides or oligosaccharides. Its unique properties, such as its steric bulk and hydrophobic nature due to the triisopropylsilyl group, contribute to its utility in organic synthesis and potential applications in medicinal chemistry. As with many chemical substances, proper handling and safety precautions should be observed due to its reactivity and potential hazards.
Formula:C15H30O4Si
InChI:InChI=1/C15H30O4Si/c1-10(2)20(11(3)4,12(5)6)19-9-14-15(17)13(16)7-8-18-14/h7-8,10-17H,9H2,1-6H3/t13-,14-,15-/m1/s1
SMILES:CC(C)[Si](C(C)C)(C(C)C)OC[C@@H]1[C@@H]([C@@H](C=CO1)O)O
Synonyms:- 2,6-anhydro-5-deoxy-1-O-[tris(1-methylethyl)silyl]-D-arabino-hex-5-enitol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
6-O-Triisopropylsilyl-D-galactal
CAS:<p>6-O-Triisopropylsilyl-D-galactal is a thioether that can be used to modify the octane number of petroleum. It can also be used as an analytical reagent for sulfur compounds and as a catalyst in desulfurization reactions. 6-O-Triisopropylsilyl-D-galactal is synthesized by reacting 6,6'-dithiodipyridine with glycerol in the presence of triisopropylsilyl chloride. The reaction is synchronous and the interaction energy between the two molecules is high. The orientation of the components (i.e., sulfoxide and sulfide) are octane and oriented, respectively.</p>Formula:C15H30O4SiPurity:Min. 95%Molecular weight:302.48 g/mol

