CAS 16606-47-6
:2,4-Diphenyl-1-butene
Description:
2,4-Diphenyl-1-butene is an organic compound characterized by its unique structure, which features a butene backbone with two phenyl groups attached at the 2 and 4 positions. This compound is classified as an alkene due to the presence of a carbon-carbon double bond, which contributes to its reactivity and potential applications in organic synthesis. It typically appears as a colorless to pale yellow liquid and is known for its aromatic properties due to the phenyl substituents. The presence of the double bond makes it susceptible to reactions such as hydrogenation, polymerization, and electrophilic addition. Additionally, 2,4-Diphenyl-1-butene may exhibit interesting physical properties, including moderate boiling and melting points, and it is generally soluble in organic solvents. Its chemical behavior can be influenced by the steric and electronic effects of the phenyl groups, making it a subject of interest in various fields, including materials science and organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C16H16
InChI:InChI=1S/C16H16/c1-14(16-10-6-3-7-11-16)12-13-15-8-4-2-5-9-15/h2-11H,1,12-13H2
InChI key:InChIKey=PWSZACWUDDFZMQ-UHFFFAOYSA-N
SMILES:C(CCC1=CC=CC=C1)(=C)C2=CC=CC=C2
Synonyms:- 1,1′-(1-Methylene-1,3-propanediyl)bis[benzene]
- 2,4-Diphenyl-1-butene
- 1-Butene, 2,4-diphenyl-
- α-Phenethylstyrene
- Benzene, 1,1′-(1-methylene-1,3-propanediyl)bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
