CAS 16606-62-5
:N-[2-(5-Hydroxy-1H-indol-3-yl)acetyl]glycine
Description:
N-[2-(5-Hydroxy-1H-indol-3-yl)acetyl]glycine, also known by its CAS number 16606-62-5, is a chemical compound that features a structure derived from both indole and glycine. This substance is characterized by the presence of an indole ring, which is a bicyclic structure consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The hydroxyl group at the 5-position of the indole contributes to its potential biological activity, while the acetyl and glycine moieties suggest that it may participate in various biochemical interactions. This compound is of interest in medicinal chemistry and biochemistry due to its potential roles in neurotransmission and as a precursor in the synthesis of other biologically relevant molecules. Its solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of study for its pharmacological properties and applications in drug development.
Formula:C12H12N2O4
InChI:InChI=1S/C12H12N2O4/c15-8-1-2-10-9(4-8)7(5-13-10)3-11(16)14-6-12(17)18/h1-2,4-5,13,15H,3,6H2,(H,14,16)(H,17,18)
InChI key:InChIKey=LFUCRBSGQMAKCO-UHFFFAOYSA-N
SMILES:C(C(NCC(O)=O)=O)C=1C=2C(NC1)=CC=C(O)C2
Synonyms:- 2-[2-(5-Hydroxy-1H-indol-3-yl)acetamido]acetic acid
- Glycine, N-[(5-hydroxy-1H-indol-3-yl)acetyl]-
- N-[2-(5-Hydroxy-1H-indol-3-yl)acetyl]glycine
- Glycine, N-[2-(5-hydroxy-1H-indol-3-yl)acetyl]-
- Glycine, N-[(5-hydroxyindol-3-yl)acetyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Hydroxy indoleacetylglycine
CAS:5-Hydroxy indoleacetylglycine is a protein analog found in human urine that has been shown to have anticancer properties. It inhibits the activity of cyclin-dependent kinases, which are involved in cell cycle regulation and tumor growth. This compound has been demonstrated to induce apoptosis (programmed cell death) in cancer cells and may have potential as an anticancer agent. Additionally, 5-Hydroxy indoleacetylglycine has been shown to inhibit the activity of certain kinases, which play a role in tumor formation and progression. Chinese researchers have identified this compound as a promising inhibitor for cancer treatment.Formula:C12H12N2O4Purity:Min. 95%Molecular weight:248.23 g/mol5-Hydroxy Indoleacetylglycine
CAS:Controlled ProductFormula:C12H12N2O4Color and Shape:NeatMolecular weight:248.235

