CAS 16611-84-0
:6-Pentadecylsalicylic acid
Description:
6-Pentadecylsalicylic acid is an organic compound characterized by its long hydrophobic pentadecyl chain attached to a salicylic acid moiety. This structure imparts both lipophilic and hydrophilic properties, making it amphiphilic. The presence of the carboxylic acid group allows for potential hydrogen bonding and solubility in polar solvents, while the long alkyl chain enhances its solubility in non-polar environments. This compound is often studied for its potential applications in pharmaceuticals and cosmetics, particularly in formulations that require emulsification or stabilization of oil-water mixtures. Additionally, its salicylic acid component suggests potential anti-inflammatory and exfoliating properties, which are beneficial in dermatological applications. The compound's unique structure may also influence its biological activity, making it a subject of interest in research related to drug delivery systems and skin penetration enhancers. Overall, 6-Pentadecylsalicylic acid exemplifies the intersection of organic chemistry and practical applications in various industries.
Formula:C22H36O3
InChI:InChI=1S/C22H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h15,17-18,23H,2-14,16H2,1H3,(H,24,25)
InChI key:InChIKey=ADFWQBGTDJIESE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(CCCCCCCCCCCCCCC)C=CC=C1O
Synonyms:- (15:0)-Anacardic acid
- 1-Hydroxy-2-carboxy-3-pentadecylbenzene
- 2-Hydroxy-6-Pentadecylbenzoic Acid
- 22:0-Anacardic acid
- 6-Pentadecyl-2-hydroxybenzoic acid
- Benzoic acid, 2-hydroxy-6-pentadecyl-
- Cyclogallipharic acid
- Ginkgolic acid C15:0
- Hydrogenated anacardic acid
- Hydroginkgolic acid
- NSC 229596
- NSC 333857
- NSC 623096
- Pentadecylsalicylicacid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Benzoic acid, 2-hydroxy-6-pentadecyl-
CAS:Formula:C22H36O3Purity:98%Color and Shape:SolidMolecular weight:348.51942-hydroxy-6-pentadecyl-benzoic acid
CAS:Formula:C22H36O3Purity:>98%Color and Shape:SolidMolecular weight:348.52Anacardic acid
CAS:Formula:C22H36O3Purity:≥ 98.0%Color and Shape:White to off-white or beige powderMolecular weight:348.52Anacardic Acid
CAS:<p>Anacardic Acid (6-pentadecylsalicylic Acid) is an effective inhibitor of p300 and p300/CBP-associated factor histone acetyltranferases.</p>Formula:C22H36O3Purity:97.47% - 99.87%Color and Shape:SolidMolecular weight:348.52(15:0)-Anacardic acid
CAS:<p>Anacardic acid is a natural compound that can be found in the leaves of Ginkgo biloba. It has been shown to inhibit protein methylation and is cytotoxic to tumor cells. Anacardic acid has also been shown to induce apoptosis by inhibiting caspase-independent cell death, which is mediated by the activation of signal pathways. These effects are likely due to its ability to inhibit protein synthesis, energy metabolism, and DNA replication.</p>Formula:C22H36O3Purity:Min. 95%Color and Shape:PowderMolecular weight:348.52 g/mol2-Hydroxy-6-pentadecylbenzoic acid
CAS:Formula:C22H36O3Purity:98%Color and Shape:SolidMolecular weight:348.527







