CAS 166176-45-0

6-CHLORO-IMIDAZO[1,2-B]PYRIDAZIN-3-AMINE

Description:

6-Chloro-imidazo[1,2-b]pyridazin-3-amine is a heterocyclic compound characterized by its imidazo and pyridazine ring structures, which contribute to its unique chemical properties. This compound features a chlorine atom at the 6-position of the imidazo ring and an amino group at the 3-position of the pyridazine moiety. The presence of these functional groups suggests potential reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, the chlorine substituent can enhance lipophilicity and alter the compound's pharmacokinetic properties. Overall, 6-chloro-imidazo[1,2-b]pyridazin-3-amine is a compound with potential applications in pharmaceuticals, particularly in the development of targeted therapies.

Formula: C₆H₅ClN₄

InChI: InChI=1/C6H5ClN4/c7-4-1-2-6-9-3-5(8)11(6)10-4/h1-3H,8H2

SMILES: c1cc2ncc(N)n2nc1Cl

Synonyms:

• 6-Chlorimidazo[1,2-b]pyridazin-3-amin
• 6-Chloroimidazo[1,2-b]pyridazin-3-amine
• Imidazo[1,2-b]pyridazin-3-amine, 6-chloro-
• 6-Chloroimidazo[1,2-B]Pyridazin-3-Ylamine

Imidazo[1,2-b]pyridazin-3-amine, 6-chloro-

CAS: 166176-45-0

Formula: C₆H₅ClN₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 168.5837

Ref: IN-DA001WJD

3-Amino-6-chloroimidazo[1,2-b]pyridazine

CAS: 166176-45-0

3-Amino-6-chloroimidazo[1,2-b]pyridazine

Purity: 96%

Molecular weight: 168.58g/mol

Ref: 54-OR952866

6-Chloroimidazo[1,2-b]pyridazin-3-ylamine

CAS: 166176-45-0

Formula: C₆H₅ClN₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 168.58

Ref: 10-F076312