CymitQuimica logo

CAS 166176-46-1

:

Imidazo[1,2-b]pyridazin-3-amine

Description:
Imidazo[1,2-b]pyridazin-3-amine is a heterocyclic organic compound characterized by its fused imidazole and pyridazine rings, which contribute to its unique chemical properties. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. Its structure includes an amino group at the 3-position of the pyridazine ring, which can participate in hydrogen bonding and influence its reactivity and solubility. Imidazo[1,2-b]pyridazin-3-amine may also display potential as a scaffold for the design of novel pharmaceuticals, particularly in targeting various biological pathways. The compound's properties, such as melting point, solubility, and stability, can vary based on the specific substituents and conditions under which it is studied. Additionally, its synthesis often involves multi-step organic reactions, highlighting its complexity and the need for careful handling in laboratory settings. Overall, this compound represents a significant area of interest for researchers exploring new therapeutic agents.
Formula:C6H6N4
InChI:InChI=1S/C6H6N4/c7-5-4-8-6-2-1-3-9-10(5)6/h1-4H,7H2
InChI key:InChIKey=OZKLSNMZRDYQAI-UHFFFAOYSA-N
SMILES:NC=1N2C(C=CC=N2)=NC1
Synonyms:
  • (Imidazo[1,2-b]pyridazin-3-yl)amine
  • 3-Aminoimidazo[1,2-b]pyridazine
  • Imidazo[1,2-B]Pyridazin-3-Amine
  • Imidazo[1,2-b]pyridazin-3-ylamine
Found 4 products.