CymitQuimica logo

CAS 1661847-01-3

:

(1E)-N′-[[(4-Fluorophenyl)amino]thioxomethyl]-N,N-dimethylmethanimidamide

Description:
The chemical substance known as (1E)-N′-[[[4-Fluorophenyl]amino]thioxomethyl]-N,N-dimethylmethanimidamide, with the CAS number 1661847-01-3, is characterized by its unique structural features that include a thioxomethyl group and a fluorophenyl moiety. This compound is classified as an organic molecule, specifically an amidine derivative, which typically exhibits properties such as basicity due to the presence of the amidine functional group. The presence of the fluorine atom in the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in various solvents. Additionally, the thioxomethyl group may impart specific biological activities, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Overall, the characteristics of this compound, including its functional groups and substituents, contribute to its chemical behavior and potential utility in various scientific fields.
Formula:C10H12FN3S
InChI:InChI=1S/C10H12FN3S/c1-14(2)7-12-10(15)13-9-5-3-8(11)4-6-9/h3-7H,1-2H3,(H,13,15)/b12-7+
InChI key:InChIKey=YOHRXWUDWAXXHB-KPKJPENVSA-N
SMILES:N(C(/N=C/N(C)C)=S)C1=CC=C(F)C=C1
Synonyms:
  • Methanimidamide, N′-[[(4-fluorophenyl)amino]thioxomethyl]-N,N-dimethyl-, (1E)-
  • (1E)-N′-[[(4-Fluorophenyl)amino]thioxomethyl]-N,N-dimethylmethanimidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.