CymitQuimica logo

CAS 166187-01-5

:

(2R,4R)-4-Hydroxy-2-pyrrolidinecarboxamide

Description:
(2R,4R)-4-Hydroxy-2-pyrrolidinecarboxamide, with the CAS number 166187-01-5, is a chemical compound characterized by its pyrrolidine ring structure, which features a hydroxyl group and a carboxamide functional group. This compound is a chiral molecule, meaning it has two enantiomers due to the presence of stereocenters at the 2 and 4 positions of the pyrrolidine ring. The hydroxyl group contributes to its potential solubility in polar solvents, while the carboxamide group can participate in hydrogen bonding, influencing its reactivity and interactions with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its stereochemistry is crucial for its biological function, as different enantiomers can have significantly different effects in biological systems. Overall, (2R,4R)-4-Hydroxy-2-pyrrolidinecarboxamide is a compound of interest in various fields, including pharmaceuticals and organic synthesis, due to its unique structural features and potential applications.
Formula:C5H10N2O2
InChI:InChI=1S/C5H10N2O2/c6-5(9)4-1-3(8)2-7-4/h3-4,7-8H,1-2H2,(H2,6,9)/t3-,4-/m1/s1
InChI key:InChIKey=OJSXAYGYRGXDSQ-QWWZWVQMSA-N
SMILES:C(N)(=O)[C@H]1C[C@@H](O)CN1
Synonyms:
  • 2-Pyrrolidinecarboxamide, 4-hydroxy-, (2R-cis)-
  • cis-4-Hydroxy-D-prolinamide
  • (2R,4R)-4-Hydroxy-2-pyrrolidinecarboxamide
  • 2-Pyrrolidinecarboxamide, 4-hydroxy-, (2R,4R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.