CAS 1662-06-2
:17α,20β-Dihydroxy-4-pregnen-3-one
Description:
17α,20β-Dihydroxy-4-pregnen-3-one, also known as Dihydroprogesterone, is a steroid hormone that plays a crucial role in the reproductive system. It is a derivative of progesterone and is characterized by the presence of hydroxyl groups at the 17α and 20β positions of the steroid nucleus. This compound is typically a white to off-white crystalline powder and is soluble in organic solvents such as ethanol and methanol, but has limited solubility in water. It is involved in various biological processes, including the regulation of the menstrual cycle and maintenance of pregnancy. The hormone exhibits significant biological activity, influencing the development of reproductive tissues and modulating immune responses. Due to its structural features, it can interact with specific steroid hormone receptors, leading to various physiological effects. Its CAS number, 1662-06-2, is used for identification in chemical databases and regulatory contexts. Overall, 17α,20β-Dihydroxy-4-pregnen-3-one is an important compound in both clinical and research settings related to endocrinology and reproductive health.
Formula:C21H32O3
InChI:InChI=1S/C21H32O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h12-13,16-18,22,24H,4-11H2,1-3H3/t13-,16-,17+,18+,19+,20+,21+/m1/s1
InChI key:InChIKey=MASCESDECGBIBB-FSHQYNQFSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)C(CC3)=CC(=O)CC4)(CC1)[H])[H])(CC[C@@]2([C@@H](C)O)O)[H]
Synonyms:- 17α,20β-Dihydroxy-4-pregnen-3-one
- (20R)-17,20-Dihydroxypregn-4-en-3-one
- Pregn-4-en-3-one, 17,20-dihydroxy-, (20R)-
- 17α-Hydroxy-20β-dihydroprogesterone
- Pregn-4-en-3-one, 17,20β-dihydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(20R)-17,20-Dihydroxypregn-4-en-3-one
CAS:Formula:C21H32O3Purity:96%Color and Shape:SolidMolecular weight:332.477017α,20β-Dihydroxy-4-pregnen-3-one
CAS:17α,20β-Dihydroxy-4-pregnen-3-onePurity:≥95%Molecular weight:332.48g/mol17α,20β-Dihydroxy-4-pregnen-3-one
CAS:17α,20β-Dihydroxy-4-pregnen-3-one (17α,20β-DHP) is an endogenous, maturation-inducing steroid that stimulates oocyte maturation in females of several teleostFormula:C21H32O3Color and Shape:SolidMolecular weight:332.484-Pregnen-17α,20β-diol-3-one
CAS:<p>Stability Store in Freezer<br>Applications 4-Pregnen-17α,20β-diol-3-one (cas# 1662-06-2) is a compound useful in organic synthesis.<br></p>Formula:C21H32O3Color and Shape:White To Light YellowMolecular weight:332.484-Pregnen-17a,20b-diol-3-one
CAS:Controlled Product<p>4-Pregnen-17a,20b-diol-3-one is a synthetic androgen with anabolic and androgenic activity. It has been shown in animal studies to increase maximal responses of the reproductive tract to gonadotropin stimulation. 4-Pregnen-17a,20b-diol-3-one binds to the activin receptor on the cell membrane, which leads to increased expression of a gene encoding for 3β-hydroxysteroid dehydrogenase (3βHSD), an enzyme involved in testosterone synthesis. This drug also increases the sensitivity of ovarian follicles to gonadotropins and decreases basal plasma levels of LH and FSH. 4-Pregnen-17a,20b-diol-3-one has not been found to be toxicologically significant at doses up to 10 mg/kg body weight per day.</p>Formula:C21H32O3Purity:Min. 95%Molecular weight:332.48 g/mol







