
CAS 16620-96-5
:1,2,3,4-Tetrahydro-6,7-dimethoxy-2-methylisoquinoline
Description:
1,2,3,4-Tetrahydro-6,7-dimethoxy-2-methylisoquinoline, with the CAS number 16620-96-5, is a chemical compound belonging to the isoquinoline family, characterized by its bicyclic structure. This compound features a tetrahydroisoquinoline core, which indicates that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of methoxy groups at the 6 and 7 positions contributes to its unique chemical properties, potentially influencing its reactivity and solubility. The methyl group at the 2 position further modifies its electronic characteristics. Generally, isoquinoline derivatives are known for their diverse biological activities, including potential pharmacological effects. The specific arrangement of substituents in this compound may impart specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its structural features suggest that it may exhibit certain physical properties such as moderate polarity and potential for hydrogen bonding, which can affect its behavior in various chemical environments. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C12H17NO2
InChI:InChI=1S/C12H17NO2/c1-13-5-4-9-6-11(14-2)12(15-3)7-10(9)8-13/h6-7H,4-5,8H2,1-3H3
InChI key:InChIKey=TXPPKWZEHFNZOE-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=CC1OC)CN(C)CC2
Synonyms:- N-Methyl-6,7-dimethoxytetrahydroisoquinoline
- Isoquinoline, 1,2,3,4-tetrahydro-6,7-dimethoxy-2-methyl-
- O-Methylcorypalline
- 1,2,3,4-Tetrahydro-6,7-dimethoxy-2-methylisoquinoline
- 6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
