CAS 16629-15-5

2-Bromo-5-chloro-1,3-thiazole

Description:

2-Bromo-5-chloro-1,3-thiazole is a heterocyclic compound characterized by a five-membered ring containing both sulfur and nitrogen atoms, specifically a thiazole structure. The presence of bromine and chlorine substituents at the 2 and 5 positions, respectively, contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a pale yellow to light brown solid, and it is soluble in organic solvents. Its molecular structure allows for participation in nucleophilic substitution reactions, making it useful in the synthesis of more complex molecules. Additionally, thiazole derivatives are known for their biological activity, which may include antimicrobial and antifungal properties. The compound's CAS number, 16629-15-5, facilitates its identification in chemical databases and regulatory frameworks. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks. Overall, 2-Bromo-5-chloro-1,3-thiazole is a valuable compound in organic synthesis and medicinal chemistry.

Formula: C₃HBrClNS

InChI: InChI=1/C3HBrClNS/c4-3-6-1-2(5)7-3/h1H

SMILES: c1c(Cl)sc(Br)n1

Synonyms:

• Thiazole, 2-Bromo-5-Chloro-
• 2-Bromo-5-chloro-thiazole

2-Bromo-5-chlorothiazole

CAS: 16629-15-5

Formula: C₃HBrClNS

Purity: 97%

Color and Shape: Liquid

Molecular weight: 198.4687

Ref: IN-DA00ALZ7

2-Bromo-5-chlorothiazole

CAS: 16629-15-5

2-Bromo-5-chlorothiazole

Purity: 95%

Color and Shape: Liquid

Molecular weight: 198.47g/mol

Ref: 54-OR301069

2-Bromo-5-chlorothiazole

CAS: 16629-15-5

Formula: C₃HBrClNS

Purity: 98%

Color and Shape: Liquid

Molecular weight: 198.46

Ref: 10-F077385