CAS 16630-91-4
:2-Methylheptanal
Description:
2-Methylheptanal is an organic compound classified as an aldehyde, characterized by its seven-carbon chain with a methyl group attached to the second carbon. Its molecular formula is C8H16O, and it features a functional aldehyde group (-CHO) at one end of the carbon chain. This compound is typically a colorless to pale yellow liquid with a distinctive odor, often described as fatty or waxy. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic carbon chain. 2-Methylheptanal is used in various applications, including as a flavoring agent and in the synthesis of other organic compounds. Its reactivity is typical of aldehydes, allowing it to participate in various chemical reactions, such as oxidation and condensation. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation to the skin and eyes. Overall, 2-Methylheptanal is an important compound in organic chemistry and industrial applications.
Formula:C8H16O
InChI:InChI=1S/C8H16O/c1-3-4-5-6-8(2)7-9/h7-8H,3-6H2,1-2H3
InChI key:InChIKey=DHEKCFIOOSCJRW-UHFFFAOYSA-N
SMILES:C(CCCCC)(C=O)C
Synonyms:- Heptanal, 2-methyl-
- 2-Methylheptanal
- 2-Methylheptan-1-al
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-Methylheptanal-d3
CAS:Controlled ProductFormula:C8D3H13OColor and Shape:NeatMolecular weight:131.231

