CAS 16633-50-4

4-fluoro-2,6-dimethylbenzoic acid

Description:

4-Fluoro-2,6-dimethylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a fluorine atom and two methyl groups. The fluorine atom is located at the para position relative to the carboxylic acid group, while the methyl groups are positioned at the 2 and 6 positions on the benzene ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, with limited solubility in water. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, where the fluorine substituent can enhance biological activity and lipophilicity. The presence of the carboxylic acid functional group allows for acid-base reactions and potential interactions with biological targets. Additionally, 4-fluoro-2,6-dimethylbenzoic acid may be used as an intermediate in organic synthesis, particularly in the development of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₉FO₂

InChI: InChI=1/C9H9FO2/c1-5-3-7(10)4-6(2)8(5)9(11)12/h3-4H,1-2H3,(H,11,12)

SMILES: Cc1cc(cc(C)c1C(=O)O)F

Synonyms:

• Benzoic Acid, 4-Fluoro-2,6-Dimethyl-
• 2,6-Dimethyl-4-Fluorobenzoic Acid

Benzoic acid, 4-fluoro-2,6-dimethyl-

CAS: 16633-50-4

Formula: C₉H₉FO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 168.1650

Ref: IN-DA001WN5

2,6-Dimethyl-4-fluorobenzoic acid

CAS: 16633-50-4

2,6-Dimethyl-4-fluorobenzoic acid

Formula: C₉H₉FO₂

Purity: ≥95%

Color and Shape: off-white powder

Molecular weight: 168.16g/mol

Ref: 54-PC8961

4-Fluoro-2,6-dimethylbenzoic acid

CAS: 16633-50-4

Formula: C₉H₉FO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.167

Ref: 10-F065851