CAS 166335-18-8

4-cyano-N-{3-[cyclopropyl(2-hydroxy-4-oxo-5,6,7,8,9,10-hexahydro-4H-cycloocta[b]pyran-3-yl)methyl]phenyl}benzenesulfonamide

Description:

4-cyano-N-{3-[cyclopropyl(2-hydroxy-4-oxo-5,6,7,8,9,10-hexahydro-4H-cycloocta[b]pyran-3-yl)methyl]phenyl}benzenesulfonamide, with CAS number 166335-18-8, is a complex organic compound characterized by its sulfonamide functional group, which typically enhances solubility and biological activity. The presence of a cyano group indicates potential reactivity and polarity, while the cyclopropyl moiety contributes to its three-dimensional structure, potentially influencing its interaction with biological targets. The compound features a phenyl ring, which is often associated with aromatic stability and hydrophobic interactions. Additionally, the hexahydro-cyclooctabenzopyran structure suggests a degree of rigidity and potential for specific conformational arrangements, which can be crucial for its pharmacological properties. Overall, this compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry, particularly in the development of therapeutic agents. Its intricate structure and functional groups suggest a multifaceted role in chemical reactivity and biological interactions.

Formula: C₂₈H₂₈N₂O₅S

InChI: InChI=1/C28H28N2O5S/c29-17-18-10-14-22(15-11-18)36(33,34)30-21-7-5-6-20(16-21)25(19-12-13-19)26-27(31)23-8-3-1-2-4-9-24(23)35-28(26)32/h5-7,10-11,14-16,19,25,30,32H,1-4,8-9,12-13H2

SMILES: C1CCCc2c(CC1)c(=O)c(C(C1CC1)c1cccc(c1)NS(=O)(=O)c1ccc(cc1)C#N)c(O)o2

PNU 103017

CAS: 166335-18-8

PNU 103017 is an experimental neuroprotective compound, which is a derivative of pharmacological agents developed for neurological research. It is sourced through synthetic modification processes aimed at enhancing specific receptor interactions in the central nervous system. Its mode of action involves targeting and modulating specific neurotransmitter receptors, such as the sigma receptors, which play a crucial role in neuronal signaling and protection against excitotoxicity.

Formula: C₂₈H₂₈N₂O₅S

Purity: Min. 95%

Molecular weight: 504.6 g/mol

Ref: 3D-RGA33518

PNU-103017

CAS: 166335-18-8

PNU-103017 is an inhibitor of HIV protease.

Formula: C₂₈H₂₈N₂O₅S

Purity: 98%

Color and Shape: Solid

Molecular weight: 504.6

Ref: TM-T16555