CAS 166374-48-7

CVT 124

Description:

CVT 124, with the CAS number 166374-48-7, is a chemical compound that belongs to the class of small molecules. It is primarily recognized for its role in pharmaceutical applications, particularly as a potential therapeutic agent. The compound exhibits specific characteristics such as a defined molecular structure, which contributes to its biological activity. CVT 124 has been studied for its effects on various biological pathways, making it of interest in drug development and research. Its solubility, stability, and reactivity are important factors that influence its efficacy and safety profile. Additionally, CVT 124 may interact with specific biological targets, which can lead to various pharmacological effects. As with many chemical substances, understanding its properties, including its mechanism of action and potential side effects, is crucial for its application in medicine. Further research and clinical studies are often necessary to fully elucidate its therapeutic potential and to establish guidelines for its use in clinical settings.

Formula: C₁₈H₂₄N₄O₃

InChI: InChI=1S/C18H24N4O3/c1-3-5-21-16-12(17(23)22(6-4-2)18(21)24)19-15(20-16)11-8-9-7-10(11)14-13(9)25-14/h9-11,13-14H,3-8H2,1-2H3,(H,19,20)/t9-,10+,11-,13-,14+/m1/s1

InChI key: InChIKey=OQCJPFYWFGUHIN-VGYDOTAVSA-N

SMILES: C(CC)N1C=2N=C([C@H]3[C@]4([C@]5([C@](O5)([C@](C4)(C3)[H])[H])[H])[H])NC2C(=O)N(CCC)C1=O

Synonyms:

• 1H-Purine-2,6-dione, 3,9-dihydro-8-(1S,2R,4S,5S,6R)-3-oxatricyclo[3.2.1.02,4]oct-6-yl-1,3-dipropyl-
• 1H-Purine-2,6-dione, 3,7-dihydro-8-(1S,2R,4S,5S,6R)-3-oxatricyclo[3.2.1.02,4]oct-6-yl-1,3-dipropyl-
• 3,9-Dihydro-8-(1S,2R,4S,5S,6R)-3-oxatricyclo[3.2.1.02,4]oct-6-yl-1,3-dipropyl-1H-purine-2,6-dione
• CVT 124
• 1H-Purine-2,6-dione, 3,7-dihydro-8-(3-oxatricyclo[3.2.1.02,4]oct-6-yl)-1,3-dipropyl-, [1S-(1α,2β,4β,5α,6β)]-

Adentri

CAS: 166374-48-7

Adentri is a novel antagonist of adenosine A1 receptor with unique diuretic activity.

Formula: C₁₈H₂₄N₄O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 344.41

Ref: TM-T26565