CAS 16641-72-8

phenyl 3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate

Description:

Phenyl 3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate, with the CAS number 16641-72-8, is a bicyclic compound characterized by its unique structural framework, which includes a bicyclo[3.2.1]octane core fused with an azabicyclic structure. This compound features a phenyl group and a carboxylate moiety, contributing to its chemical reactivity and potential biological activity. The presence of the carbonyl group (3-oxo) indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. The azabicyclic structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to mimic natural products or interact with biological targets. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its practical applications. Overall, phenyl 3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate represents a compound of interest in organic synthesis and drug discovery.

Formula: C₁₄H₁₅NO₃

InChI: InChI=1/C14H15NO3/c16-12-8-10-6-7-11(9-12)15(10)14(17)18-13-4-2-1-3-5-13/h1-5,10-11H,6-9H2