CAS 16642-93-6
:3-Cyanocinnamic acid
Description:
3-Cyanocinnamic acid, with the CAS number 16642-93-6, is an organic compound characterized by its aromatic structure and functional groups. It features a cinnamic acid backbone, which consists of a trans-styryl group attached to a carboxylic acid, along with a cyano group (-CN) at the 3-position of the phenyl ring. This compound typically appears as a solid, often in crystalline form, and is known for its potential applications in organic synthesis and materials science. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. The presence of the cyano group contributes to its reactivity, making it a useful intermediate in various chemical reactions, including those involving nucleophilic additions. Additionally, 3-Cyanocinnamic acid may exhibit interesting photophysical properties, making it a candidate for studies in photochemistry and related fields. Its unique structure and functional groups allow for diverse applications in pharmaceuticals and agrochemicals.
Formula:C10H7NO2
InChI:InChI=1/C10H7NO2/c11-7-9-3-1-2-8(6-9)4-5-10(12)13/h1-6H,(H,12,13)/b5-4+
Synonyms:- Rarechem Bk Hw 0149
- 2-Propenoic Acid, 3-(3-Cyanophenyl)-
- Akos Bar-2476
- (2E)-3-(3-cyanophenyl)prop-2-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
trans-3-(3-Cyanophenyl)acrylic acid
CAS:Formula:C10H7NO2Purity:98%Color and Shape:SolidMolecular weight:173.16813-Cyanocinnamic acid
CAS:3-Cyanocinnamic acidFormula:C10H7NO2Purity:98%Color and Shape: white solidMolecular weight:173.17g/mol3-Cyanocinnamic acid
CAS:3-Cyanocinnamic acid is a reactive, unreactive, and stepwise cycloaddition compound. It can participate in photochemical reactions with other compounds to form photodimers. 3-Cyanocinnamic acid has an optimal reaction temperature of 100°C and a reaction time of 5 minutes. The diradical nature of 3-cyanocinnamic acid makes it sensitive to UV light, and the photochemical reactions are simulated by quantum mechanics calculations. Photodimerisation simulations show that 3-cyanocinnamic acid is capable of forming photodimers with 2-cyanocinnamic acid or 4-cyanocinnamic acid at room temperature.Formula:C10H7NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:173.17 g/mol



