CAS 16642-94-7
:(2E)-3-(4-Cyanophenyl)-2-propenoic acid
Description:
(2E)-3-(4-Cyanophenyl)-2-propenoic acid, also known as 4-cyanocinnamic acid, is an organic compound characterized by its conjugated double bond system and a cyano group attached to a phenyl ring. This compound features a propenoic acid backbone, which contributes to its reactivity and potential applications in organic synthesis. The presence of the cyano group enhances its polarity and can influence its solubility in various solvents. Typically, it appears as a solid at room temperature and may exhibit a crystalline structure. The compound is of interest in various fields, including materials science and pharmaceuticals, due to its potential as a building block for more complex molecules. Its reactivity allows for participation in various chemical reactions, such as Michael additions and polymerization processes. Additionally, the compound's unique structural features may impart specific optical properties, making it useful in applications like photonic materials. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H7NO2
InChI:InChI=1S/C10H7NO2/c11-7-9-3-1-8(2-4-9)5-6-10(12)13/h1-6H,(H,12,13)/b6-5+
InChI key:InChIKey=USVZQKYCNGNRBV-AATRIKPKSA-N
SMILES:C(=C/C(O)=O)\C1=CC=C(C#N)C=C1
Synonyms:- (2E)-3-(4-Cyanophenyl)-2-propenoic acid
- (2E)-3-(4-cyanophenyl)prop-2-enoic acid
- (E)-3-(4-Cyanophenyl)-2-propenoic acid
- (E)-3-(4-Cyanophenyl)acrylic acid
- (E)-4-Cyanocinnamic acid
- 2-Propenoic acid, 3-(4-cyanophenyl)-, (2E)-
- 2-Propenoic acid, 3-(4-cyanophenyl)-, (E)-
- 4-Cyanocinnamic acid 98%
- Akos Bar-2475
- Cinnamic acid, p-cyano-, (E)-
- Rarechem Bk Hd C008
- trans-3-(4-Cyanophenyl)-2-propenoic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Propenoic acid, 3-(4-cyanophenyl)-, (2E)-
CAS:Formula:C10H7NO2Purity:97%Color and Shape:SolidMolecular weight:173.1681trans-4-Cyanocinnamic acid
CAS:trans-4-Cyanocinnamic acidFormula:C10H7NO2Purity:98%Color and Shape: white solidMolecular weight:173.17g/mol2-Propenoic acid, 3-(4-cyanophenyl)-, (E)-
CAS:2-Propenoic acid, 3-(4-cyanophenyl)-, (E)- is a fatty acid that is used in the production of biodiesel. This reaction is catalyzed by an acid methyl ester, which can be either reactive or unreactive. The product of this reaction - fatty acid methyl esters - has significant activity as an anion and has a high boiling point. It also has the potential to be used as a fuel in the future.
Formula:C10H7NO2Purity:Min. 95%Molecular weight:173.17 g/mol



