CAS 166439-15-2

2,2,6,6-Tetramethyl-3,5-heptanedionato rubidium [Rb(TMHD)]

Description:

2,2,6,6-Tetramethyl-3,5-heptanedionato rubidium, commonly referred to as Rb(TMHD), is a coordination compound characterized by its unique structure and properties. It is a rubidium salt of the heptanedione ligand, which features bulky tetramethyl groups that enhance its solubility and stability in organic solvents. Rb(TMHD) typically appears as a solid, often exhibiting a yellow to orange color due to the presence of the metal center. This compound is known for its use in various applications, including as a precursor in the synthesis of rubidium-containing materials and in the field of organometallic chemistry. Its coordination chemistry is significant, as it can form complexes with various ligands, influencing its reactivity and interaction with other substances. Additionally, Rb(TMHD) is of interest in materials science and catalysis due to its potential role in the development of advanced materials and chemical processes. Safety precautions should be observed when handling this compound, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₁₁H₁₉O₂Rb

InChI: InChI=1/C11H20O2.Rb/c1-10(2,3)8(12)7-9(13)11(4,5)6;/h7,12H,1-6H3;/q;+1/p-1/b8-7-;

SMILES: CC(C)(C)C(=CC(=O)C(C)(C)C)O.[Rb]

Synonyms:

• [(Z)-1-tert-butyl-4,4-dimethyl-3-oxo-pent-1-enoxy]rubidium

2,2,6,6-Tetramethyl-3,5-heptanedionato rubidium [Rb(TMHD)]

CAS: 166439-15-2

2,2,6,6-Tetramethyl-3,5-heptanedionato rubidium [Rb(TMHD)]

Formula: RbC₁₁H₁₉O₂

Color and Shape: white to off-white pwdr.

Molecular weight: 268.74

Ref: 08-37-5000