CAS 16650-37-6
:bicyclo[3.1.0]hexane-6-carboxylic acid
Description:
Bicyclo[3.1.0]hexane-6-carboxylic acid is a bicyclic organic compound characterized by its unique structural framework, which consists of a bicyclohexane system with a carboxylic acid functional group. This compound features a bicyclic structure that includes two fused cyclopropane rings, contributing to its distinctive chemical properties. The presence of the carboxylic acid group (-COOH) imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and decarboxylation. The compound is typically colorless to pale yellow and may exhibit moderate solubility in polar solvents due to the polar nature of the carboxylic acid group. Its reactivity can be influenced by the strain inherent in the bicyclic structure, which may lead to unique reaction pathways compared to more linear or less strained compounds. Bicyclo[3.1.0]hexane-6-carboxylic acid can be of interest in organic synthesis and materials science, particularly in the development of novel polymers or as intermediates in the synthesis of more complex molecules.
Formula:C7H10O2
InChI:InChI=1/C7H10O2/c8-7(9)6-4-2-1-3-5(4)6/h4-6H,1-3H2,(H,8,9)
SMILES:C1CC2C(C1)C2C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
BICYCLO[3.1.0]HEXANE-6-CARBOXYLIC ACID
CAS:Formula:C7H10O2Purity:96%Color and Shape:SolidMolecular weight:126.1531Bicyclo[3.1.0]hexane-6-carboxylic acid
CAS:Bicyclo[3.1.0]hexane-6-carboxylic acidPurity:96%Molecular weight:126.15g/molBicyclo[3.1.0]hexane-6-carboxylic Acid (endo/exo Mixture)
CAS:Controlled ProductFormula:C7H10O2Color and Shape:NeatMolecular weight:126.153Bicyclo[3.1.0]hexane-6-carboxylic acid, somers
CAS:Bicyclo[3.1.0]hexane-6-carboxylic acid, somers is an organic compound that is a carboxylic acid derivative with a cyclopentane ring and six carboxyl groups. It is used in the synthesis of other compounds, such as hydroxyalkyl, tetrahydropyranyl, sulfur, carboxylic acid, alkylthio, c1-6 alkyl, cycloalkyl and efficient carboxylic. Bicyclo[3.1.0]hexane-6-carboxylic acid, somers can be synthesized from bicyclo[2.2.1]heptane-2-carboxylic acid by reaction with ethylene oxide and hydrogen sulfide in the presence of a catalytic amount of hydrochloric acid or pyridine hydrochloride.Formula:C7H10O2Purity:Min. 95%Molecular weight:126.15 g/mol




