CAS 16650-53-6

6-Chloro-1-naphthalenecarboxylic acid

Description:

6-Chloro-1-naphthalenecarboxylic acid is an aromatic compound characterized by the presence of a naphthalene ring substituted with a carboxylic acid group and a chlorine atom at the 6-position. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents, while being less soluble in water. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. The chlorine substituent can influence the compound's reactivity and polarity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 6-Chloro-1-naphthalenecarboxylic acid can serve as an intermediate in the synthesis of more complex molecules. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential health hazards, including skin and respiratory irritation. Proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₁₁H₇ClO₂

InChI: InChI=1S/C11H7ClO2/c12-8-4-5-9-7(6-8)2-1-3-10(9)11(13)14/h1-6H,(H,13,14)

InChI key: InChIKey=SSQYFWFMNFKLBB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C=C(Cl)C=C2)C=CC1

Synonyms:

• 6-Chloro-1-naphthoic acid
• 1-Naphthoic acid, 6-chloro-
• 1-Naphthalenecarboxylic acid, 6-chloro-
• 6-Chloro-1-naphthalenecarboxylic acid

5-Amino-3-[(4-chlorophenyl)amino]-1h-1,2,4-triazole

CAS: 16650-53-6

Formula: C₁₁H₇ClO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 206.6251

Ref: IN-DA001WSL

6-Chloronaphthalene-1-carboxylic acid

CAS: 16650-53-6

Purity: 97%

Molecular weight: 206.6300049

Ref: 10-F675514

6-Chloronaphthalene-1-carboxylic acid

CAS: 16650-53-6

6-Chloronaphthalene-1-carboxylic acid is a chlorinated aromatic compound with the chemical formula ClCH=CClO2H. The compound was first synthesized in 1887 by Friedel and Crafts reaction between aluminum chloride and 2-furoic acid. It is an intermediate in the production of chlorobenzene, which is used to make polychlorinated biphenyls (PCBs). 6-Chloronaphthalene-1-carboxylic acid can be prepared by nitration of benzene or toluene, followed by hydrolysis with hydrochloric acid. It also has applications as a herbicide.

Formula: C₁₁H₇ClO₂

Purity: Min. 95%

Molecular weight: 206.62 g/mol

Ref: 3D-RAA65053