CAS 166526-03-0

4,6-dichloropyridine-3-carbonitrile

Description:

4,6-Dichloropyridine-3-carbonitrile is a heterocyclic organic compound characterized by a pyridine ring substituted with two chlorine atoms at the 4 and 6 positions and a cyano group (-C≡N) at the 3 position. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its bioactive properties. The presence of the cyano group contributes to its reactivity, making it useful in various synthetic pathways. The dichloropyridine structure enhances its lipophilicity and may influence its interaction with biological targets. Additionally, this compound may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during its use in laboratory or industrial settings. Its solubility characteristics can vary depending on the solvent, and it is generally stable under standard conditions, although it may undergo hydrolysis or other reactions under specific circumstances. Overall, 4,6-dichloropyridine-3-carbonitrile is a versatile compound with significant relevance in chemical research and development.

Formula: C₆H₂Cl₂N₂

InChI: InChI=1/C6H2Cl2N2/c7-5-1-6(8)10-3-4(5)2-9/h1,3H

SMILES: c1c(c(C#N)cnc1Cl)Cl

Synonyms:

• 3-Pyridinecarbonitrile, 4,6-dichloro-
• 4,6-Dichloronicotinonitrile

3-Pyridinecarbonitrile, 4,6-dichloro-

CAS: 166526-03-0

Formula: C₆H₂Cl₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.9995

Ref: IN-DA001WSZ

4,6-Dichloronicotinonitrile

CAS: 166526-03-0

4,6-Dichloronicotinonitrile

Purity: 97%

Color and Shape: Orange Solid

Molecular weight: 173.00g/mol

Ref: 54-OR303715

4,6-Dichloronicotinonitrile

CAS: 166526-03-0

Formula: C₆H₂Cl₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 173

Ref: 10-F217597