CAS 166526-05-2
:1-cyclopropyl-2-methoxy-ethanone
Description:
1-Cyclopropyl-2-methoxy-ethanone, with the CAS number 166526-05-2, is an organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring, contributing to its distinctive reactivity and strain. The presence of a methoxy group (-OCH3) enhances its solubility in organic solvents and can influence its chemical behavior, particularly in nucleophilic substitution reactions. As an ethanone derivative, it features a carbonyl group (C=O), which is pivotal in determining its reactivity, particularly in condensation and addition reactions. The compound's molecular structure suggests potential applications in organic synthesis and medicinal chemistry, where such functional groups are often involved in the development of pharmaceuticals. Additionally, the presence of both cyclic and acyclic components may impart interesting physical properties, such as boiling and melting points, which are influenced by intermolecular forces. Overall, 1-cyclopropyl-2-methoxy-ethanone is a versatile compound with potential utility in various chemical applications.
Formula:C6H10O2
InChI:InChI=1/C6H10O2/c1-8-4-6(7)5-2-3-5/h5H,2-4H2,1H3
SMILES:COCC(=O)C1CC1
Synonyms:- 1-Cyclopropyl-2-Methoxyethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
