CAS 166530-78-5
:5-BROMO-2-METHOXYBENZYLAMINE
Description:
5-Bromo-2-methoxybenzylamine is an organic compound characterized by its aromatic structure, which includes a bromine atom and a methoxy group attached to a benzylamine framework. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity, while the methoxy group contributes to its electron-donating properties, enhancing the compound's nucleophilicity. This compound typically appears as a solid at room temperature and is soluble in organic solvents due to its hydrophobic aromatic nature. It may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The amine functional group can participate in hydrogen bonding, affecting its interactions in biological systems. Additionally, the compound's structure suggests potential applications in synthesis and as a building block for more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-bromo-2-methoxybenzylamine is a versatile compound with significant implications in various chemical and pharmaceutical contexts.
Formula:C8H10BrNO
InChI:InChI=1/C8H10BrNO/c1-11-8-3-2-7(9)4-6(8)5-10/h2-4H,5,10H2,1H3
Synonyms:- 1-(5-Bromo-2-Methoxyphenyl)Methanamine
- Benzenemethanamine, 5-Bromo-2-Methoxy-
- (5-Bromo-2-Methoxy-Phenyl)Methanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenemethanamine, 5-bromo-2-methoxy-
CAS:Formula:C8H10BrNOPurity:95%Color and Shape:LiquidMolecular weight:216.0751(5-Bromo-2-methoxyphenyl)methanamine
CAS:(5-Bromo-2-methoxyphenyl)methanamineFormula:C8H10BrNOPurity:98%Color and Shape: light yellow liquidMolecular weight:216.08g/mol(5-Bromo-2-methoxyphenyl)methanamine
CAS:Formula:C8H10BrNOPurity:95%Color and Shape:LiquidMolecular weight:216.078(5-bromo-2-methoxyphenyl)methanamine
CAS:Versatile small molecule scaffold
Formula:C8H10BrNOPurity:Min. 95%Molecular weight:216.1 g/molRef: 3D-RGA53078
Discontinued product



