CAS 1666-28-0
:4-Bromo-2-hydroxybenzoic acid
Description:
4-Bromo-2-hydroxybenzoic acid, also known as bromosalicylic acid, is an aromatic compound characterized by the presence of a bromine atom and a hydroxyl group attached to a benzoic acid structure. Its molecular formula is C7H6BrO3, indicating that it contains seven carbon atoms, six hydrogen atoms, one bromine atom, and three oxygen atoms. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents while exhibiting limited solubility in water. The presence of the hydroxyl group contributes to its acidity, making it a weak acid. 4-Bromo-2-hydroxybenzoic acid is often used in various chemical syntheses and can serve as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, including potential antimicrobial properties. As with many brominated compounds, it is important to handle it with care due to potential environmental and health impacts.
Formula:C7H5BrO3
InChI:InChI=1/C7H5BrO3/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,9H,(H,10,11)
SMILES:c1cc(c(cc1Br)O)C(=O)O
Synonyms:- 4-Bromosalicylic Acid
- 4-Bromo-2-Hydroxybenzoic Acid 2-Hydroxy-4-Bromobenzoic Acid
- 2-Hydroxy-4-bromobenzoicacid
- 4-Bromo-2-hydroxybenzoic acid 98%
- 4-Bromo-2-Hydroxy-Benzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 4-bromo-2-hydroxy-
CAS:Formula:C7H5BrO3Purity:98%Color and Shape:SolidMolecular weight:217.0168Ref: IN-DA001WUK
1g21.00€5g29.00€10g35.00€25g62.00€50g88.00€5kgTo inquire100g132.00€10kgTo inquire250g229.00€25kgTo inquire500g531.00€4-Bromo-2-hydroxybenzoic acid
CAS:4-Bromo-2-hydroxybenzoic acidFormula:C7H5BrO3Purity:98%Color and Shape: orange powderMolecular weight:217.0168g/mol4-Bromo-2-hydroxybenzoic acid
CAS:4-Bromo-2-hydroxybenzoic acid is a viscometric, anticancer drug that is used in the treatment of cancer. It inhibits the production of dioxane and cyclic peptide, which are important for cancer cell proliferation. 4-Bromo-2-hydroxybenzoic acid has also been shown to have antimycobacterial activity against Mycobacterium tuberculosis and antitubercular activity against Mycobacterium avium complex. This drug has a potent inhibitory effect on u87 cells and has a significant antitumor activity. The mechanism of action involves inhibiting the synthesis of p-hydroxybenzoic acid by hydrogen peroxide in the oxidation of salicylic acid.
Formula:C7H5BrO3Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:217.02 g/mol4-Bromo-2-hydroxybenzoic acid
CAS:Formula:C7H5BrO3Purity:95%Color and Shape:Solid, PowderMolecular weight:217.018



