CAS 16661-00-0

Daucene

Description:

Daucene, with the CAS number 16661-00-0, is a naturally occurring sesquiterpene hydrocarbon primarily derived from the essential oils of certain plants, particularly those in the Apiaceae family. It is characterized by its complex bicyclic structure, which contributes to its unique aroma and potential biological activities. Daucene is typically colorless to pale yellow in appearance and has a distinctive, pleasant fragrance, making it of interest in the fragrance and flavor industries. In terms of solubility, it is generally hydrophobic, dissolving well in organic solvents but poorly in water. Daucene has been studied for its potential antimicrobial and antifungal properties, although further research is needed to fully understand its mechanisms and applications. Additionally, it may exhibit insecticidal activity, which has implications for agricultural use. As with many natural compounds, the specific characteristics of daucene can vary depending on its source and extraction methods.

Formula: C₁₅H₂₄

InChI: InChI=1S/C15H24/c1-11(2)13-8-10-15(4)9-7-12(3)5-6-14(13)15/h7,11H,5-6,8-10H2,1-4H3

InChI key: InChIKey=MGMBZNCFUFRSSP-UHFFFAOYSA-N

SMILES: CC12C(=C(C(C)C)CC1)CCC(C)=CC2

Synonyms:

• Daucene
• Azulene, 1,2,4,5,8,8a-hexahydro-6,8a-dimethyl-3-(1-methylethyl)-
• 2,3,3a,4,7,8-Hexahydro-3a,6-dimethyl-1-(1-methylethyl)azulene
• Azulene, 1,2,4,5,8,8a-hexahydro-3-isopropyl-6,8a-dimethyl-
• Azulene, 2,3,3a,4,7,8-hexahydro-3a,6-dimethyl-1-(1-methylethyl)-

Daucene

CAS: 16661-00-0

Daucene is a sesquiterpene lactone, which is isolated from plant sources, particularly from certain species of the Apiaceae family. It functions through modulating cellular pathways, primarily by inhibiting the NF-κB signaling pathway and inducing apoptosis in cancerous cells. This biochemical mode of action demonstrates Daucene's potential in disrupting cancer cell proliferation and promoting cell cycle arrest.

Formula: C₁₅H₂₄

Purity: Min. 95%

Molecular weight: 204.35 g/mol

Ref: 3D-FD174947