CAS 16667-96-2
:1,2:5,6-Di-O-isopropylidene-a-D-glucofuranose S-Methyl Dithiocarbonate
Description:
1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose S-methyl dithiocarbonate is a chemical compound that combines a protected form of glucose with a dithiocarbonate functional group. The presence of the isopropylidene groups indicates that the hydroxyl groups of the glucose are protected, which enhances the compound's stability and solubility in organic solvents. The dithiocarbonate moiety introduces a reactive site that can participate in various chemical reactions, making it useful in synthetic organic chemistry. This compound is typically utilized in carbohydrate chemistry for the synthesis of glycosides or as an intermediate in the preparation of more complex molecules. Its structure suggests it may exhibit specific stereochemical properties due to the configuration of the glucose unit, which can influence its reactivity and interactions with other chemical species. Overall, this compound is significant in the field of organic synthesis, particularly in the development of carbohydrate-based materials and pharmaceuticals.
Formula:C14H22O6S2
InChI:InChI=1/C14H22O6S2/c1-13(2)15-6-7(18-13)8-9(17-12(21)22-5)10-11(16-8)20-14(3,4)19-10/h7-11H,6H2,1-5H3
SMILES:CC1(C)OCC(C2C(C3C(O2)OC(C)(C)O3)OC(=S)SC)O1
Synonyms:- 1,2:5,6-Bis-O-(1-methylethylidene)-a-D-glucofuranose 3-(S-Methyl Carbonodithioate
- Nsc 40973
- Nsc 409733
- O-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-6-yl] S-methyl carbonodithioate (non-preferred name)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-D-Glucofuranose, 1,2:5,6-bis-O-(1-methylethylidene)-, 3-(S-methyl carbonodithioate)
CAS:Formula:C14H22O6S2Purity:95%Color and Shape:LiquidMolecular weight:350.4509Ref: IN-DA001WVV
1gTo inquire2gTo inquire5gTo inquire10gTo inquire100mg246.00€250mg586.00€500mg588.00€1,2:5,6-Di-O-isopropylidene-a-D-glucofuranose S-methyl dithiocarbonate
CAS:1,2:5,6-Di-O-isopropylidene-a-D-glucofuranose S-methyl dithiocarbonate is an organic compound that is used in the synthesis of 3,4-dihydroquinazolines. 1,2:5,6-Di-O-isopropylidene-a-D-glucofuranose S-methyl dithiocarbonate is a reagent that reacts with alkenes to form acrylonitrile and methyl iodide. It can also be used to synthesize phenyl substituted alkyl iodides by reacting with an aldehyde or substituents.Formula:C14H22O6S2Purity:Min. 95%Molecular weight:350.45 g/mol


