CAS 16672-78-9
:(4-CYANO-PHENYL)-PHOSPHONIC ACID
Description:
(4-Cyano-phenyl)-phosphonic acid, with the CAS number 16672-78-9, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group attached to a phenyl ring that has a cyano substituent at the para position. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the phosphonic acid group. It exhibits acidic properties, allowing it to donate protons in solution. The cyano group contributes to its reactivity and potential applications in organic synthesis and materials science. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stability under various conditions, along with its ability to form complexes with metal ions, further enhances its utility in various chemical applications. As with many organophosphorus compounds, safety precautions should be taken during handling due to potential toxicity.
Formula:C7H6NO3P
InChI:InChI=1/C7H6NO3P/c8-5-6-1-3-7(4-2-6)12(9,10)11/h1-4H,(H2,9,10,11)
SMILES:c1cc(ccc1C#N)P(=O)(O)O
Synonyms:- (4-Cyanophenyl)phosphonic acid
- Phosphonic Acid, (4-Cyanophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Cyanophenylphosphonic Acid
CAS:Controlled ProductFormula:C7H6NO3PColor and Shape:NeatMolecular weight:183.101
