CAS 166734-81-2
:(R)-Imazalil
Description:
(R)-Imazalil is a chiral imidazole derivative primarily used as a fungicide in agricultural applications. It exhibits broad-spectrum antifungal activity, making it effective against various plant pathogens. The compound is characterized by its ability to inhibit the biosynthesis of ergosterol, a vital component of fungal cell membranes, thereby disrupting fungal growth and reproduction. (R)-Imazalil is typically applied to crops to protect them from fungal infections, particularly in post-harvest treatments. It is known for its relatively low toxicity to humans and animals when used according to recommended guidelines. The substance is also subject to regulatory scrutiny to ensure environmental safety and efficacy. Its chiral nature allows for specific interactions with biological systems, which can enhance its fungicidal properties. In terms of physical characteristics, (R)-Imazalil is generally a solid at room temperature, with solubility in organic solvents, and it may exhibit stability under various environmental conditions, although it can degrade under extreme pH or temperature. Overall, (R)-Imazalil plays a significant role in modern agriculture as a targeted fungicide.
Formula:C14H14Cl2N2O
InChI:InChI=1S/C14H14Cl2N2O/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16/h2-6,8,10,14H,1,7,9H2/t14-/m0/s1
InChI key:InChIKey=PZBPKYOVPCNPJY-AWEZNQCLSA-N
SMILES:[C@@H](CN1C=CN=C1)(OCC=C)C2=C(Cl)C=C(Cl)C=C2
Synonyms:- (R)-Imazalil
- 1H-Imidazole, 1-[(2R)-2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]-
- 1H-Imidazole, 1-[(2R)-2-(2,4-dichlorophenyl)-2-(2-propen-1-yloxy)ethyl]-
- 1-[(2R)-2-(2,4-Dichlorophenyl)-2-(2-propen-1-yloxy)ethyl]-1H-imidazole
- 1H-Imidazole, 1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]-, (R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(R)-Imazalil
CAS:<p>(R)-Imazalil is a protein kinase inhibitor that has been shown to inhibit the growth of tumor cells in humans. It is an analog of indirubin, which is known for its anticancer properties. (R)-Imazalil has been shown to induce apoptosis in cancer cells by inhibiting the activity of kinases, which are enzymes involved in cell signaling pathways. This drug has also been found to have a potent inhibitory effect on the growth of Chinese hamster ovary cells and human breast cancer cells. Additionally, (R)-Imazalil has been detected in urine samples from patients with cancer, suggesting that it may have potential as an anticancer agent.</p>Formula:C14H14Cl2N2OPurity:Min. 95%Molecular weight:297.2 g/mol

