CAS 1668-84-4

1,3-BENZODIOXOL-4-AMINE

Description:

1,3-Benzodioxol-4-amine, with the CAS number 1668-84-4, is an organic compound characterized by its unique bicyclic structure that includes a benzodioxole moiety and an amine functional group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to act as a building block in the synthesis of more complex molecules. The presence of the amine group allows for further functionalization, making it a versatile intermediate in organic synthesis. Additionally, compounds with similar structures have been studied for their biological activities, including potential effects on neurotransmitter systems. However, safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 1,3-benzodioxol-4-amine is a significant compound in organic chemistry with implications in medicinal chemistry and material science.

Formula: C₇H₇NO₂

InChI: InChI=1/C7H7NO2/c8-5-2-1-3-6-7(5)10-4-9-6/h1-3H,4,8H2

SMILES: c1cc(c2c(c1)OCO2)N

Synonyms:

• 1,3-Benzodioxol-4-amine
• Aniline, 2,3-(methylenedioxy)-
• 2,3-Methylenedioxyaniline
• benzo[d][1,3]dioxol-4-amine
• 2H-1,3-benzodioxol-4-aMine

4-Amino-1,3-benzodioxole

CAS: 1668-84-4

Formula: C₇H₇NO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 137.1360

Ref: IN-DA001WYJ

1,3-Benzodioxol-4-amine

CAS: 1668-84-4

1,3-Benzodioxol-4-amine

Formula: C₇H₇NO₂

Purity: 97%

Color and Shape: brown powder

Molecular weight: 137.14g/mol

Ref: 54-OR350054

1,3-Benzodioxol-4-amine

CAS: 1668-84-4

Formula: C₇H₇NO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 137.138

Ref: 10-F093565