CAS 16681-59-7
:2-Bromo-1-methyl-1H-imidazole
Description:
2-Bromo-1-methyl-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring structure, which contains nitrogen atoms that contribute to its basicity and reactivity. The presence of a bromine atom at the second position and a methyl group at the first position of the imidazole ring influences its chemical properties, making it a useful intermediate in organic synthesis and medicinal chemistry. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar organic solvents, which enhances its utility in various chemical reactions. 2-Bromo-1-methyl-1H-imidazole can participate in nucleophilic substitution reactions due to the electrophilic nature of the bromine atom, making it valuable for the synthesis of more complex molecules. Additionally, its imidazole structure is often associated with biological activity, contributing to its potential applications in pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C4H5BrN2
InChI:InChI=1S/C4H5BrN2/c1-7-3-2-6-4(7)5/h2-3H,1H3
InChI key:InChIKey=BANOTGHIHYMTDL-UHFFFAOYSA-N
SMILES:BrC=1N(C)C=CN1
Synonyms:- 2-Bromo-N-methylimidazole
- 1H-Imidazole, 2-bromo-1-methyl-
- 2-Bromo-1-methylimidazole
- Imidazole, 2-bromo-1-methyl-
- 2-Bromo-1-methyl-1H-imidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Bromo-1-methylimidazole, 95%
CAS:2-Bromo-1-methylimidazole is used in in pharmaceuticals, drug candidates, ligands for transition metal catalysts and other molecular functional materials. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label informationFormula:C4H5BrN2Purity:95%Molecular weight:161.02-bromo-1-methyl-1H-imidazole
CAS:Formula:C4H5BrN2Purity:97%Color and Shape:LiquidMolecular weight:160.99992-Bromo-1-methyl-1H-imidazole
CAS:2-Bromo-1-methyl-1H-imidazoleFormula:C4H5BrN2Purity:95%Color and Shape: dark red-brown liquidMolecular weight:161.00g/mol2-Bromo-1-methyl-1H-imidazole
CAS:Formula:C4H5BrN2Purity:97%Color and Shape:LiquidMolecular weight:161.0022-Bromo-1-methyl-1H-imidazole
CAS:Please enquire for more information about 2-Bromo-1-methyl-1H-imidazole including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C4H5BrN2Purity:Min. 95%Molecular weight:161 g/mol





