CAS 16681-72-4

5-bromo-1-methyl-1,2,4-triazole

Description:

5-Bromo-1-methyl-1,2,4-triazole is a heterocyclic organic compound characterized by its five-membered ring structure containing three nitrogen atoms and two carbon atoms. The presence of a bromine atom at the 5-position and a methyl group at the 1-position contributes to its unique chemical properties. This compound is typically a white to off-white crystalline solid and is soluble in polar organic solvents. It exhibits a range of biological activities, making it of interest in agricultural and pharmaceutical applications, particularly as a fungicide and in the synthesis of various bioactive molecules. The triazole ring is known for its ability to form hydrogen bonds, which can influence its reactivity and interactions with other compounds. Additionally, 5-bromo-1-methyl-1,2,4-triazole can undergo various chemical transformations, including substitution and oxidation reactions, which are valuable in synthetic chemistry. Its stability and reactivity profile make it a useful intermediate in organic synthesis and a subject of study in medicinal chemistry.

Formula: C₃H₄BrN₃

InChI: InChI=1/C3H4BrN3/c1-7-3(4)5-2-6-7/h2H,1H3

SMILES: Cn1c(Br)ncn1

Synonyms:

• 1H-1,2,4-Triazole, 5-bromo-1-methyl-
• 5-bromo-1-methyl-1H-1,2,4-triazole

5-bromo-1-methyl-1,2,4-triazole

CAS: 16681-72-4

Formula: C₃H₄BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.9880

Ref: IN-DA00AKA2

5-Bromo-1-methyl-1H-1,2,4-triazole

CAS: 16681-72-4

5-Bromo-1-methyl-1H-1,2,4-triazole

Purity: 97%

Molecular weight: 161.99g/mol

Ref: 54-OR904770

5-Bromo-1-methyl-1H-1,2,4-triazole

CAS: 16681-72-4

Formula: C₃H₄BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.99

Ref: 10-F079815