CAS 16684-31-4
:N-cbz-D-glucosamine crystalline
Description:
N-Cbz-D-glucosamine crystalline, with the CAS number 16684-31-4, is a derivative of glucosamine, an amino sugar that plays a crucial role in the synthesis of glycosaminoglycans and glycoproteins. This compound features a carbobenzyloxy (Cbz) protecting group, which enhances its stability and solubility, making it useful in various chemical reactions, particularly in organic synthesis and medicinal chemistry. N-Cbz-D-glucosamine is typically a white to off-white crystalline solid, exhibiting good solubility in organic solvents such as methanol and dimethyl sulfoxide (DMSO). Its molecular structure includes an amino group, a hydroxyl group, and a sugar backbone, which contribute to its reactivity and potential applications in drug development and biochemistry. The presence of the Cbz group allows for selective deprotection, facilitating further functionalization of the glucosamine moiety. Overall, N-Cbz-D-glucosamine is valued for its versatility in synthetic chemistry and its role in the study of carbohydrate-based compounds.
Formula:C14H19NO7
InChI:InChI=1/C14H19NO7/c16-6-10(12(19)13(20)11(18)7-17)15-14(21)22-8-9-4-2-1-3-5-9/h1-6,10-13,17-20H,7-8H2,(H,15,21)
SMILES:c1ccc(cc1)COC(=NC(C=O)C(C(C(CO)O)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Benzyl ((2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)carbamate
CAS:Formula:C14H19NO7Color and Shape:SolidMolecular weight:313.3032N-Cbz-D-glucosamine
CAS:N-Cbz-D-glucosamine is a synthetic molecule that is used in the synthesis of oligosaccharides. It is an acceptor for choline hydroxylase and participates in the biosynthesis of glycoproteins. N-Cbz-D-glucosamine inhibits virus RNA synthesis and has been shown to be effective against uninfected cells. The ring opening of the molecule leads to the formation of a cyclic amide, which can inhibit protein synthesis by binding to ribosomes.Formula:C14H19NO7Purity:Min. 95%Color and Shape:PowderMolecular weight:313.3 g/mol2-N-Carbobenzyloxy-2-deoxy-D-glucosamine
CAS:Controlled ProductFormula:C14H19NO7Color and Shape:NeatMolecular weight:313.3





