CAS 16687-60-8
:5-(4-Nitrophenyl)-1H-tetrazole
Description:
5-(4-Nitrophenyl)-1H-tetrazole is an organic compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. The presence of a nitrophenyl group at the 5-position of the tetrazole ring imparts unique chemical properties, including increased reactivity and potential applications in various fields such as pharmaceuticals and materials science. This compound is typically a crystalline solid and may exhibit notable thermal stability, making it suitable for use in energetic materials. Its nitro group contributes to its electron-withdrawing characteristics, influencing its reactivity in nucleophilic substitution reactions. Additionally, 5-(4-Nitrophenyl)-1H-tetrazole can participate in various chemical transformations, including coupling reactions and the formation of azo compounds. Due to its structural features, it may also exhibit interesting biological activities, warranting further investigation in medicinal chemistry. Safety precautions should be taken when handling this compound, as nitro-substituted compounds can be hazardous.
Formula:C7H5N5O2
InChI:InChI=1/C7H5N5O2/c13-12(14)6-3-1-5(2-4-6)7-8-10-11-9-7/h1-4H,(H,8,9,10,11)
InChI key:MIUOBAHGBPSRKY-UHFFFAOYSA-N
SMILES:c1cc(ccc1c1n[nH]nn1)N(=O)=O
Synonyms:- 5-(4-Nitrophenyl)tetrazole
- 5-(4-nitrophenyl)-2H-tetrazole
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
5-(4-Nitrophenyl)-1H-tetrazole, 97%
CAS:It is used as a reagent used as activator for both solution- and solid-phase synthesis of oligonucleotides using the phosphoramidite method. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to tFormula:C7H5N5O2Purity:97%Color and Shape:Crystals or powder or crystalline powder or fused solid or granules, Pale yellow to yellow to orange to pale brownMolecular weight:191.155-(4-Nitrophenyl)-1H-tetrazole
CAS:5-(4-Nitrophenyl)-1H-tetrazoleFormula:C7H5N5O2Purity:>98%Color and Shape:SolidMolecular weight:191.14695-(4-Nitrophenyl)-1H-tetrazole
CAS:Formula:C7H5N5O2Purity:98%Color and Shape:SolidMolecular weight:191.14695-(4-Nitrophenyl)-1H-tetrazole
CAS:5-(4-Nitrophenyl)-1H-tetrazoleFormula:C7H5N5O2Purity:97%Molecular weight:191.155-(4-Nitrophenyl)-1H-tetrazole
CAS:Formula:C7H5N5O2Purity:95.0%Color and Shape:SolidMolecular weight:191.15
