CAS 166907-09-1
:(3R,4R,5S,6S)-5-azido-6-benzyloxy-2-(hydroxymethyl)tetrahydropyran-3,4-diol
Description:
The chemical substance known as (3R,4R,5S,6S)-5-azido-6-benzyloxy-2-(hydroxymethyl)tetrahydropyran-3,4-diol, with the CAS number 166907-09-1, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and includes hydroxymethyl and azido groups that contribute to its reactivity and potential applications in organic synthesis. The presence of a benzyloxy group enhances its lipophilicity, making it more soluble in organic solvents. This compound is of interest in medicinal chemistry and biochemistry due to its potential as a building block for more complex molecules, particularly in the development of pharmaceuticals. Its stereochemical configuration suggests that it may exhibit specific biological activities, which could be explored in further research. Overall, this compound exemplifies the intricate nature of organic molecules and their diverse functionalities in chemical applications.
Formula:C13H17N3O5
InChI:InChI=1/C13H17N3O5/c14-16-15-10-12(19)11(18)9(6-17)21-13(10)20-7-8-4-2-1-3-5-8/h1-5,9-13,17-19H,6-7H2/t9?,10-,11-,12+,13-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-D-Galactopyranoside, phenylmethyl 2-azido-2-deoxy-
CAS:Formula:C13H17N3O5Color and Shape:SolidMolecular weight:295.2912Benzyl 2-azido-2-deoxy-a-D-galactopyranoside
CAS:Benzyl 2-azido-2-deoxy-a-D-galactopyranoside (α-OBn GalN3) is a compound based on the structural features of α-OBn GalNAc. It features an azide functionality at C2 instead of the N-acetyl. α-OBn GalN3 inhibits glycosyltransferases responsible for O-GalNAc-type glycosylation and induces apoptosis in PC/AA/C1/SB10C and HCA7/C29 cells. The compound was tested at 0.5 mM for 4 days with different colorectal cell lines and showed an inhibition of cell growth. α-OBn GalN3 was also used as an intermediate for the total synthesis of (+)-Neocarzinostatin chromophore.
Formula:C13H17N3O5Purity:Min. 95%Molecular weight:295.29 g/mol


