CAS 16692-52-7
:3,5,7,4′-Tetramethoxyflavone
Description:
3,5,7,4′-Tetramethoxyflavone, with the CAS number 16692-52-7, is a flavonoid compound characterized by its four methoxy groups attached to the flavone backbone. This structure contributes to its unique chemical properties, including enhanced solubility in organic solvents and potential biological activity. The presence of methoxy groups can influence the compound's antioxidant properties, making it of interest in pharmacological research. It is typically found in various plant sources and may exhibit anti-inflammatory, anti-cancer, and neuroprotective effects, although specific biological activities can vary based on the context of use. The compound's molecular structure allows for interactions with various biological targets, which is a focus of ongoing studies in natural product chemistry and medicinal applications. Additionally, its stability and reactivity can be influenced by environmental factors, such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 3,5,7,4′-Tetramethoxyflavone represents a significant compound in the study of flavonoids and their potential health benefits.
Formula:C19H18O6
InChI:InChI=1S/C19H18O6/c1-21-12-7-5-11(6-8-12)18-19(24-4)17(20)16-14(23-3)9-13(22-2)10-15(16)25-18/h5-10H,1-4H3
InChI key:InChIKey=YZWIIEJLESXODL-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(OC(=C(OC)C2=O)C3=CC=C(OC)C=C3)=CC(OC)=C1
Synonyms:- 3,5,7-Trimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- O-Tetramethylkaempferol
- 4H-1-Benzopyran-4-one, 3,5,7-trimethoxy-2-(4-methoxyphenyl)-
- 2-(4-Methoxyphenyl)-3,5,7-trimethoxy-4-oxo-4H-1-benzopyran
- Flavone, 3,4′,5,7-tetramethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tetramethylkaempferol
CAS:Tetramethylkaempferol boosts insulin sensitivity and adipogenesis by elevating adiponectin and triglycerides.Formula:C19H18O6Purity:99.57%Color and Shape:SolidMolecular weight:342.34Ref: TM-TN5137
1mg104.00€5mg227.00€10mg338.00€25mg558.00€50mg797.00€100mg1,074.00€1mL*10mM (DMSO)259.00€3,5,7,4'-Tetramethoxyflavone
CAS:3,5,7,4'-Tetramethoxyflavone is a flavonoid that has been shown to have antidiabetic effects in animal studies. The mechanism of action of 3,5,7,4'-tetramethoxyflavone is not clear; however it is thought to involve the regulation of insulin sensitivity and energy metabolism. This compound has also been shown to inhibit the growth of Mycobacterium tuberculosis and other bacteria by interacting with their adenosine receptors. 3,5,7,4'-Tetramethoxyflavone binds to the basophilic leukemia cell line and inhibits its uptake of adenosine through the ccaat/enhancer-binding protein complex.
Formula:C19H18O6Purity:Min. 95%Molecular weight:342.34 g/mol



