CAS 16694-30-7
:4-Oxooctadecanoic acid
Description:
4-Oxooctadecanoic acid, also known as 4-oxystearic acid, is a fatty acid derivative characterized by the presence of a ketone functional group at the fourth carbon of the octadecanoic acid chain. This compound typically appears as a white to off-white solid and is soluble in organic solvents while exhibiting limited solubility in water due to its long hydrophobic hydrocarbon chain. The presence of the ketone group introduces unique reactivity, allowing it to participate in various chemical reactions, such as oxidation and reduction processes. It is often utilized in the synthesis of surfactants, emulsifiers, and other chemical intermediates. Additionally, 4-oxooctadecanoic acid may exhibit biological activity, making it of interest in biochemical research. Its molecular structure contributes to its physical properties, including melting and boiling points, which are influenced by the length of the carbon chain and the functional groups present. Overall, this compound serves as a valuable building block in organic synthesis and materials science.
Formula:C18H34O3
InChI:InChI=1S/C18H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(19)15-16-18(20)21/h2-16H2,1H3,(H,20,21)
InChI key:InChIKey=NARNRJNUUFXXBI-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCC)(CCC(O)=O)=O
Synonyms:- 4-Oxooctadecanoic acid
- 4-Ketostearic acid
- Octadecanoic acid, 4-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
