CAS 166941-66-8
:ethyl (5S)-5-phenyl-L-prolinate
Description:
Ethyl (5S)-5-phenyl-L-prolinate, with the CAS number 166941-66-8, is an organic compound that belongs to the class of proline derivatives. It features a proline backbone, which is an amino acid known for its role in protein structure and function. The compound is characterized by the presence of an ethyl ester group and a phenyl substituent at the 5-position of the proline ring, contributing to its unique chemical properties. Ethyl (5S)-5-phenyl-L-prolinate is typically a white to off-white solid and is soluble in organic solvents, making it useful in various chemical reactions and syntheses. Its chirality, indicated by the (5S) configuration, suggests that it may exhibit specific biological activities or interactions, which can be of interest in pharmaceutical applications. The compound may also be involved in asymmetric synthesis processes, where it can serve as a chiral auxiliary or catalyst. Overall, its structural features and stereochemistry make it a valuable compound in organic chemistry and medicinal research.
Formula:C13H17NO2
InChI:InChI=1/C13H17NO2/c1-2-16-13(15)12-9-8-11(14-12)10-6-4-3-5-7-10/h3-7,11-12,14H,2,8-9H2,1H3/t11-,12-/m0/s1
SMILES:CCOC(=O)[C@@H]1CC[C@@H](c2ccccc2)N1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
