CymitQuimica logo

CAS 166947-11-1

:

2-[Methyl(phenylmethyl)amino]acetaldehyde

Description:
2-[Methyl(phenylmethyl)amino]acetaldehyde, with the CAS number 166947-11-1, is an organic compound characterized by the presence of an aldehyde functional group and an amine moiety. This compound features a methyl group and a phenylmethyl group attached to a nitrogen atom, which contributes to its unique chemical properties. The aldehyde group is reactive, making it susceptible to oxidation and condensation reactions. The presence of the aromatic phenyl group can influence the compound's solubility and reactivity, often enhancing its stability compared to aliphatic amines. Additionally, the compound may exhibit biological activity, which is common among amine-containing aldehydes, potentially making it of interest in pharmaceutical research. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic additions and electrophilic substitutions. Overall, 2-[Methyl(phenylmethyl)amino]acetaldehyde is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c1-11(7-8-12)9-10-5-3-2-4-6-10/h2-6,8H,7,9H2,1H3
InChI key:InChIKey=IODYXSKLZFZLSS-UHFFFAOYSA-N
SMILES:C(N(CC=O)C)C1=CC=CC=C1
Synonyms:
  • Acetaldehyde, 2-[methyl(phenylmethyl)amino]-
  • 2-[Methyl(phenylmethyl)amino]acetaldehyde
  • Acetaldehyde, [methyl(phenylmethyl)amino]-
  • 2-[Benzyl(methyl)amino]acetaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.