CAS 166953-64-6

benzyl 4-bromotetrahydro-1(2H)-pyridinecarboxylate

Description:

Benzyl 4-bromotetrahydro-1(2H)-pyridinecarboxylate is a chemical compound characterized by its unique structure, which includes a tetrahydropyridine ring and a bromine substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the benzyl group and the cyclic amine structure. It is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its hydrophobic characteristics. The bromine atom introduces a level of reactivity, making it a potential candidate for further chemical transformations, such as nucleophilic substitutions or coupling reactions. Additionally, the presence of the carboxylate group suggests potential for interactions with various biological systems, which may be of interest in medicinal chemistry. Overall, benzyl 4-bromotetrahydro-1(2H)-pyridinecarboxylate is a versatile compound with applications in organic synthesis and potentially in pharmaceutical development.

Formula: C₁₃H₁₆BrNO₂

InChI: InChI=1/C13H16BrNO2/c14-12-6-8-15(9-7-12)13(16)17-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2

SMILES: c1ccc(cc1)COC(=O)N1CCC(CC1)Br

Synonyms:

• Benzyl 4-Bromopiperidine-1-Carboxylate

1-Piperidinecarboxylic acid, 4-bromo-, phenylmethyl ester

CAS: 166953-64-6

Formula: C₁₃H₁₆BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 298.1756

Ref: IN-DA001X1X

4-Bromopiperidine, N-CBZ protected

CAS: 166953-64-6

4-Bromopiperidine, N-CBZ protected

Purity: 96%

Color and Shape: Liquid

Molecular weight: 298.18g/mol

Ref: 54-OR23107

benzyl 4-bromopiperidine-1-carboxylate

CAS: 166953-64-6

Formula: C₁₃H₁₆BrNO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 298.18

Ref: 10-F356584