CAS 166954-07-0

Piperazine, 1-(2,6-dimethyl-4-pyridinyl)- (9CI)

Description:

Piperazine, 1-(2,6-dimethyl-4-pyridinyl)-, also known by its CAS number 166954-07-0, is a chemical compound that belongs to the piperazine class of compounds, which are characterized by a six-membered ring containing two nitrogen atoms. This specific derivative features a pyridine ring substituted at the 2 and 6 positions with methyl groups, contributing to its unique properties. The presence of the piperazine and pyridine moieties suggests potential biological activity, making it of interest in medicinal chemistry. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of nitrogen atoms, which can engage in hydrogen bonding. The compound's structure may influence its pharmacological properties, including its ability to interact with various biological targets. As with many piperazine derivatives, it may have applications in the development of pharmaceuticals, particularly in the fields of psychiatry and neurology, due to its potential effects on neurotransmitter systems. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₁₁H₁₇N₃

InChI: InChI=1/C11H17N3/c1-9-7-11(8-10(2)13-9)14-5-3-12-4-6-14/h7-8,12H,3-6H2,1-2H3

SMILES: Cc1cc(cc(C)n1)N1CCNCC1

Synonyms:

• 1-(2,6-Dimethylpyridin-4-Yl)Piperazine
• 1-(2,6-Dimethyl-4-Pyridyl)Piperazine

1-(2,6-Dimethylpyridin-4-yl)piperazine

CAS: 166954-07-0

Formula: C₁₁H₁₇N₃

Color and Shape: Solid

Molecular weight: 191.2728

Ref: IN-DA001X1V

1-(2,6-dimethylpyridin-4-yl)piperazine

CAS: 166954-07-0

Formula: C₁₁H₁₇N₃

Purity: 95.0%

Molecular weight: 191.278

Ref: 10-F308651