CAS 166964-34-7

5-{[(4-chlorobenzoyl)amino]methyl}thiophene-2-sulfonyl chloride

Description:

5-{[(4-chlorobenzoyl)amino]methyl}thiophene-2-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a thiophene ring, a five-membered aromatic heterocycle containing sulfur, which contributes to its unique electronic properties. The presence of a 4-chlorobenzoyl group indicates that it has a chlorinated aromatic moiety, enhancing its potential for electrophilic substitution reactions. The amino group attached to the benzoyl moiety suggests that it can participate in various coupling reactions, making it useful in synthetic organic chemistry. Additionally, the sulfonyl chloride group is a versatile electrophile, allowing for the introduction of sulfonamide functionalities in further chemical transformations. Overall, this compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules. Its reactivity and structural features make it a valuable compound for researchers in various fields.

Formula: C₁₂H₉Cl₂NO₃S₂

InChI: InChI=1/C12H9Cl2NO3S2/c13-9-3-1-8(2-4-9)12(16)15-7-10-5-6-11(19-10)20(14,17)18/h1-6H,7H2,(H,15,16)

SMILES: c1cc(ccc1C(=O)NCc1ccc(s1)S(=O)(=O)Cl)Cl

Synonyms:

• 5-({[(4-Chlorophenyl)Carbonyl]Amino}Methyl)Thiophene-2-Sulfonyl Chloride

2-Thiophenesulfonyl chloride, 5-[[(4-chlorobenzoyl)amino]methyl]-

CAS: 166964-34-7

Formula: C₁₂H₉Cl₂NO₃S₂

Purity: %

Color and Shape: Solid

Molecular weight: 350.2408

Ref: IN-DA001X2Q

5-{[(4-Chlorobenzoyl)amino]methyl}thiophene-2-sulphonyl chloride

CAS: 166964-34-7

5-{[(4-Chlorobenzoyl)amino]methyl}thiophene-2-sulphonyl chloride

Purity: 95%

Molecular weight: 350.24g/mol

Ref: 54-OR4699