CAS 166964-35-8

4-Bromo-5-chloro-2-thiophenesulfonyl chloride

Description:

4-Bromo-5-chloro-2-thiophenesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, contributing to its unique electronic properties. The presence of bromine and chlorine substituents on the thiophene ring enhances its reactivity, making it useful in various synthetic applications, particularly in the development of pharmaceuticals and agrochemicals. As a sulfonyl chloride, it can participate in nucleophilic substitution reactions, allowing for the introduction of amines or alcohols to form sulfonamides or sulfonates. The compound is typically handled with caution due to its potential to release hydrochloric acid upon hydrolysis and its reactivity with water and nucleophiles. Overall, 4-Bromo-5-chloro-2-thiophenesulfonyl chloride is a valuable intermediate in organic synthesis, particularly in the field of medicinal chemistry.

Formula: C₄HBrCl₂O₂S₂

InChI: InChI=1S/C4HBrCl2O2S2/c5-2-1-3(10-4(2)6)11(7,8)9/h1H

InChI key: InChIKey=PABOKJJDABSQCK-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=CC(Br)=C(Cl)S1

Synonyms:

• 2-Thiophenesulfonyl Chloride, 4-Bromo-5-Chloro-
• 3-Bromo-2-chlorothiophene-5-sulfonyl chloride
• 4-Bromo-5-Chlorothiophene-2-Sulfonyl Chloride
• 4-Bromo-5-chloro-2-thiophenesulfonyl chloride

2-Thiophenesulfonyl chloride, 4-bromo-5-chloro-

CAS: 166964-35-8

Formula: C₄HBrCl₂O₂S₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 295.9895

Ref: IN-DA001X2P

3-Bromo-2-chlorothiophene-5-sulphonyl chloride

CAS: 166964-35-8

3-Bromo-2-chlorothiophene-5-sulphonyl chloride

Formula: C₄HBrCl₂O₂S₂

Purity: ≥95%

Color and Shape: light beige/faint grey solid

Molecular weight: 295.98954g/mol

Ref: 54-OR29142

4-Bromo-5-chlorothiophene-2-sulfonyl chloride

CAS: 166964-35-8

Purity: 97%

Molecular weight: 295.9700012

Ref: 10-F626518

3-Bromo-2-chlorothiophene-5-sulphonyl chloride

CAS: 166964-35-8

3-Bromo-2-chlorothiophene-5-sulphonyl chloride is a low-molecular weight inhibitor. It has been shown to inhibit the activity of aminopeptidases, which are enzymes that break down amino acids. The inhibition of aminopeptidases has been shown to reduce the production of hormone and peptide hormones in animal and human cells. 3-Bromo-2-chlorothiophene-5-sulphonyl chloride also has an inhibitory potency against tetrazole and other inhibitors. This compound may be effective as a research tool for studying the function of aminopeptidases.

Purity: Min. 95%

Molecular weight: 295.99 g/mol

Ref: 3D-RGA96435