CymitQuimica logo

CAS 166970-54-3

:

Allyl(chloropropyl)dichlorosilane

Description:
Allyl(chloropropyl)dichlorosilane, with the CAS number 166970-54-3, is an organosilicon compound characterized by the presence of a silicon atom bonded to two chlorine atoms and an allyl group, along with a chloropropyl substituent. This compound typically exhibits a clear to yellowish liquid form and is known for its reactivity due to the presence of both the allyl and chloropropyl groups, which can participate in various chemical reactions, including polymerization and cross-linking processes. Its structure allows for potential applications in the synthesis of silicone polymers, surface modification, and as a coupling agent in composite materials. The dichlorosilane functional group contributes to its ability to react with moisture, leading to the formation of siloxane bonds. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it may be corrosive and harmful upon contact with skin or if inhaled. Overall, its unique chemical properties make it a valuable compound in materials science and chemical synthesis.
Formula:C6H11Cl3Si
InChI:InChI=1/C6H11Cl3Si/c1-2-5-10(8,9)6-3-4-7/h2H,1,3-6H2
SMILES:C=CC[Si](CCCCl)(Cl)Cl
Synonyms:
  • Allylchloropropyldichlorosilane
  • Dichloro(3-Chloropropyl)Prop-2-En-1-Ylsilane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.