CAS 166974-23-8
:sodium 4,6-dichloro-3-[(E)-(2-oxo-1-phenyl-pyrrolidin-3-ylidene)methyl]-1H-indole-2-carboxylate
Description:
Sodium 4,6-dichloro-3-[(E)-(2-oxo-1-phenyl-pyrrolidin-3-ylidene)methyl]-1H-indole-2-carboxylate is a chemical compound characterized by its complex structure, which includes an indole ring, a carboxylate group, and a pyrrolidine moiety. This compound features multiple chlorine substituents, which can influence its reactivity and biological activity. The presence of the indole structure often suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its role in various biological processes. The compound's sodium salt form indicates its solubility in water, which is beneficial for biological assays and formulations. Additionally, the presence of the phenyl group and the keto-enamine system may contribute to its electronic properties and interactions with biological targets. Overall, this compound's unique structural features suggest it may possess interesting pharmacological properties, warranting further investigation in drug discovery and development contexts.
Formula:C20H13Cl2N2NaO3
InChI:InChI=1/C20H14Cl2N2O3.Na/c21-12-9-15(22)17-14(18(20(26)27)23-16(17)10-12)8-11-6-7-24(19(11)25)13-4-2-1-3-5-13;/h1-5,8-10,23H,6-7H2,(H,26,27);/q;+1/p-1/b11-8+;
SMILES:c1ccc(cc1)N1CCC(=Cc2c3c(cc(cc3[nH]c2C(=O)O)Cl)Cl)C1=O.[Na]
Synonyms:- 1H-Indole-2-carboxylic acid, 4,6-dichloro-3-((E)-(2-oxo-1-phenyl-3-pyrrolidinylidene)methyl)-, monosodium salt
- Monosodium 4,6-dichloro-3-((E)-(2-oxo-1-phenyl-3-pyrrolidinylidene)methyl)-1H-indole-2-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Indole-2-carboxylic acid, 4,6-dichloro-3-[(E)-(2-oxo-1-phenyl-3-pyrrolidinylidene)methyl]-, sodium salt (1:1)
CAS:Formula:C20H13Cl2N2NaO3Molecular weight:423.2246GV-196771a
CAS:GV-196771a is a metabotropic glutamate receptor (mGluR) antagonist. It blocks the action of glutamate, a neurotransmitter that activates mGluRs. GV-196771a has been shown to be effective in the treatment of chronic schizophrenia, as well as symptoms such as anxiety, depression and Parkinson's disease. The drug is also neuroprotective and can prevent damage to neurons caused by toxins or strokes. GV-196771a binds to the mGluR5 receptor and blocks activation by glutamate. This prevents the release of other neurotransmitters that are involved in pain transmission, such as dopamine, norepinephrine, serotonin and acetylcholine.Formula:C20H13Cl2N2NaO3Purity:Min. 95%Molecular weight:423.2 g/molGV-196771A
CAS:GV-196771A A novel NMDA receptor glycine site antagonist with potent antinociceptive activity.
Formula:C20H13Cl2N2NaO3Purity:96.43%Color and Shape:SolidMolecular weight:423.23



