CAS 166978-46-7
:7-BROMO-4,4-DIMETHYL-3,4-DIHYDRO-2H-NAPHTHALEN-1-ONE
Description:
7-Bromo-4,4-dimethyl-3,4-dihydro-2H-naphthalen-1-one is an organic compound characterized by its naphthalene structure, which features a bromine substituent and two methyl groups. This compound belongs to the class of ketones, specifically a substituted naphthalenone, indicating the presence of a carbonyl group (C=O) within its structure. The bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions. The dimethyl groups contribute to the compound's steric bulk, which can influence its reactivity and interactions with other molecules. In terms of physical properties, compounds of this type typically exhibit moderate solubility in organic solvents and may have distinct melting and boiling points influenced by their molecular structure. The presence of the bromine atom and the ketone functional group can also affect the compound's spectral characteristics, making it identifiable through techniques such as NMR and IR spectroscopy. Overall, this compound may have applications in organic synthesis and medicinal chemistry, particularly in the development of brominated derivatives.
Formula:C12H13BrO
InChI:InChI=1/C12H13BrO/c1-12(2)6-5-11(14)9-7-8(13)3-4-10(9)12/h3-4,7H,5-6H2,1-2H3
SMILES:CC1(C)CCC(=O)c2cc(ccc12)Br
Synonyms:- 7-Bromo-4,4-dimethyl-1-tetralone
- 7-bromo-4,4-dimethyl-3,4-dihydronaphthalen-1(2H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1(2H)-Naphthalenone, 7-bromo-3,4-dihydro-4,4-dimethyl-
CAS:Formula:C12H13BrOPurity:96%Color and Shape:SolidMolecular weight:253.13507-Bromo-4,4-dimethyl-3,4-dihydronaphthalen-1(2H)-one
CAS:7-Bromo-4,4-dimethyl-3,4-dihydronaphthalen-1(2H)-onePurity:99%Molecular weight:253.14g/mol7-BROMO-4,4-DIMETHYL-3,4-DIHYDRONAPHTHALEN-1(2H)-ONE
CAS:Formula:C12H13BrOPurity:96%Color and Shape:SolidMolecular weight:253.1397-Bromo-4,4-dimethyl-1-tetralone
CAS:Controlled Product<p>Applications Intermediate in the production of high affinity retinoic acid receptor (RAR) antagonists.<br>References Vuligonda, V., et al.: Bioorg. Med. Chem. Lett., 9, 743 (1999), Johnson, A., et al.: Bioorg. Med. Chem. Lett., 9, 573 (1999),<br></p>Formula:C12H13BrOColor and Shape:NeatMolecular weight:253.147-Bromo-4,4-dimethyl-1-tetralone
CAS:<p>7-Bromo-4,4-dimethyl-1-tetralone is a retinoic acid receptor agonist that is used in the treatment of psoriasis. 7-Bromo-4,4-dimethyl-1-tetralone binds to the retinoic acid receptor and activates it. It also inhibits epidermal growth factor receptor (EGFR) and vascular endothelial growth factor receptor (VEGFR). This drug has been shown to be effective in the treatment of psoriasis. 7-Bromo-4,4-dimethyl-1 -tetralone is an analog of retinoic acid and may have similar effects as this compound. !-- --> !-- --> !-- --> !-- --> --></p>Formula:C12H13BrOPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:253.14 g/mol




